C10H12Cl2N2O3S — CID 64608038
4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-oxazepane (PubChem CID 64608038) has the molecular formula C10H12Cl2N2O3S and a molecular weight of 311.19 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-oxazepane.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 64608038 |
| Molecular Formula | C10H12Cl2N2O3S |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-1,4-oxazepane |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CCCOCC1 |
| InChI | InChI=1S/C10H12Cl2N2O3S/c11-9-6-8(7-13-10(9)12)18(15,16)14-2-1-4-17-5-3-14/h6-7H,1-5H2 |
| InChIKey | FKEIUAZNWIHFAR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|