C12H14Cl2N2O3S — CID 64607076
4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (PubChem CID 64607076) has the molecular formula C12H14Cl2N2O3S and a molecular weight of 337.23 g/mol. Its IUPAC name is 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine.
| Compound Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
|---|---|
| PubChem CID | 64607076 |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.23 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 4-[(5,6-dichloro-3-pyridinyl)sulfonyl]-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| SMILES | O=S(=O)(c1cnc(Cl)c(Cl)c1)N1CCOC2CCCC21 |
| InChI | InChI=1S/C12H14Cl2N2O3S/c13-9-6-8(7-15-12(9)14)20(17,18)16-4-5-19-11-3-1-2-10(11)16/h6-7,10-11H,1-5H2 |
| InChIKey | BMTDBRMUQYEAFS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|