C13H20N4O3S — CID 62152943
5-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)-N-methylpyrimidin-2-amine (PubChem CID 62152943) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 5-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)-N-methylpyrimidin-2-amine.
| Compound Name | 5-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 62152943 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-ylsulfonyl)-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)N2CCOC3CCCCC32)cn1 |
| InChI | InChI=1S/C13H20N4O3S/c1-14-13-15-8-10(9-16-13)21(18,19)17-6-7-20-12-5-3-2-4-11(12)17/h8-9,11-12H,2-7H2,1H3,(H,14,15,16) |
| InChIKey | QODINVXKYFFPGW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |