C16H17F6NO3S — CID 95574865
(4aS,8aS)-4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 95574865) has the molecular formula C16H17F6NO3S and a molecular weight of 417.37 g/mol. Its IUPAC name is (4aS,8aS)-4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | (4aS,8aS)-4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 95574865 |
| Molecular Formula | C16H17F6NO3S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | (4aS,8aS)-4-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | O=S(=O)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCO[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C16H17F6NO3S/c17-15(18,19)10-7-11(16(20,21)22)9-12(8-10)27(24,25)23-5-6-26-14-4-2-1-3-13(14)23/h7-9,13-14H,1-6H2/t13-,14-/m0/s1 |
| InChIKey | SKMBXPCELVDFDW-KBPBESRZSA-N |
| XLogP | 4.06 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |