C12H16ClNO3S2 — CID 52985795
4-(5-chlorothiophen-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 52985795) has the molecular formula C12H16ClNO3S2 and a molecular weight of 321.85 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 52985795 |
| Molecular Formula | C12H16ClNO3S2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | O=S(=O)(c1ccc(Cl)s1)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C12H16ClNO3S2/c13-11-5-6-12(18-11)19(15,16)14-7-8-17-10-4-2-1-3-9(10)14/h5-6,9-10H,1-4,7-8H2 |
| InChIKey | YHMLDSPAMJCDCB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |