C14H18ClNO3S — CID 47256567
4-(2-chlorophenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine (PubChem CID 47256567) has the molecular formula C14H18ClNO3S and a molecular weight of 315.82 g/mol. Its IUPAC name is 4-(2-chlorophenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine.
| Compound Name | 4-(2-chlorophenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
|---|---|
| PubChem CID | 47256567 |
| Molecular Formula | C14H18ClNO3S |
| Molecular Weight | 315.82 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 4-(2-chlorophenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazine |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCOC2CCCCC21 |
| InChI | InChI=1S/C14H18ClNO3S/c15-11-5-1-4-8-14(11)20(17,18)16-9-10-19-13-7-3-2-6-12(13)16/h1,4-5,8,12-13H,2-3,6-7,9-10H2 |
| InChIKey | OJQJZUOCJQBAHX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |