C11H14ClNO3S — CID 61408875
[1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 61408875) has the molecular formula C11H14ClNO3S and a molecular weight of 275.76 g/mol. Its IUPAC name is [1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 61408875 |
| Molecular Formula | C11H14ClNO3S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [1-(2-chlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1Cl)N1CCCC1CO |
| InChI | InChI=1S/C11H14ClNO3S/c12-10-5-1-2-6-11(10)17(15,16)13-7-3-4-9(13)8-14/h1-2,5-6,9,14H,3-4,7-8H2 |
| InChIKey | QWMLYJBXXOQHNM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |