C14H16FNO5S — CID 154755365
3-[[(3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]sulfonyl]-5-fluorobenzoic acid (PubChem CID 154755365) has the molecular formula C14H16FNO5S and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-[[(3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]sulfonyl]-5-fluorobenzoic acid.
| Compound Name | 3-[[(3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]sulfonyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 154755365 |
| Molecular Formula | C14H16FNO5S |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 3-[[(3aR,7aR)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyridin-4-yl]sulfonyl]-5-fluorobenzoic acid |
| SMILES | O=C(O)c1cc(F)cc(S(=O)(=O)N2CCC[C@H]3OCC[C@H]32)c1 |
| InChI | InChI=1S/C14H16FNO5S/c15-10-6-9(14(17)18)7-11(8-10)22(19,20)16-4-1-2-13-12(16)3-5-21-13/h6-8,12-13H,1-5H2,(H,17,18)/t12-,13-/m1/s1 |
| InChIKey | SWHKEAKPKTYUIY-CHWSQXEVSA-N |
| XLogP | 1.47 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |