C14H18F2N2O2S — CID 62275261
1-(3,5-difluorophenyl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine (PubChem CID 62275261) has the molecular formula C14H18F2N2O2S and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine.
| Compound Name | 1-(3,5-difluorophenyl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine |
|---|---|
| PubChem CID | 62275261 |
| Molecular Formula | C14H18F2N2O2S |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 1-(3,5-difluorophenyl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCCC1C1CCCN1 |
| InChI | InChI=1S/C14H18F2N2O2S/c15-10-7-11(16)9-12(8-10)21(19,20)18-6-2-4-14(18)13-3-1-5-17-13/h7-9,13-14,17H,1-6H2 |
| InChIKey | LIGLNQHIROYCDD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |