C12H15F2NO3S — CID 43574533
[1-(3,5-difluorophenyl)sulfonylpiperidin-2-yl]methanol (PubChem CID 43574533) has the molecular formula C12H15F2NO3S and a molecular weight of 291.32 g/mol. Its IUPAC name is [1-(3,5-difluorophenyl)sulfonylpiperidin-2-yl]methanol.
| Compound Name | [1-(3,5-difluorophenyl)sulfonylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 43574533 |
| Molecular Formula | C12H15F2NO3S |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [1-(3,5-difluorophenyl)sulfonylpiperidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)N1CCCCC1CO |
| InChI | InChI=1S/C12H15F2NO3S/c13-9-5-10(14)7-12(6-9)19(17,18)15-4-2-1-3-11(15)8-16/h5-7,11,16H,1-4,8H2 |
| InChIKey | NYDJSMJBVPSDQM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |