C11H13Cl2NO3S — CID 66260963
[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 66260963) has the molecular formula C11H13Cl2NO3S and a molecular weight of 310.20 g/mol. Its IUPAC name is [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 66260963 |
| Molecular Formula | C11H13Cl2NO3S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1CCC[C@H]1CO |
| InChI | InChI=1S/C11H13Cl2NO3S/c12-8-4-9(13)6-11(5-8)18(16,17)14-3-1-2-10(14)7-15/h4-6,10,15H,1-3,7H2/t10-/m0/s1 |
| InChIKey | NGZRSTWHHILKGL-JTQLQIEISA-N |
| XLogP | 2.14 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |