C9H12ClN3O3S — CID 61409927
[1-(2-chloropyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanol (PubChem CID 61409927) has the molecular formula C9H12ClN3O3S and a molecular weight of 277.73 g/mol. Its IUPAC name is [1-(2-chloropyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanol.
| Compound Name | [1-(2-chloropyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 61409927 |
| Molecular Formula | C9H12ClN3O3S |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | [1-(2-chloropyrimidin-5-yl)sulfonylpyrrolidin-2-yl]methanol |
| SMILES | O=S(=O)(c1cnc(Cl)nc1)N1CCCC1CO |
| InChI | InChI=1S/C9H12ClN3O3S/c10-9-11-4-8(5-12-9)17(15,16)13-3-1-2-7(13)6-14/h4-5,7,14H,1-3,6H2 |
| InChIKey | OWODNKQBJOMXSC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |