C12H14FNO5S — CID 61408927
2-fluoro-5-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 61408927) has the molecular formula C12H14FNO5S and a molecular weight of 303.31 g/mol. Its IUPAC name is 2-fluoro-5-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-fluoro-5-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 61408927 |
| Molecular Formula | C12H14FNO5S |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 2-fluoro-5-[2-(hydroxymethyl)pyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)N2CCCC2CO)ccc1F |
| InChI | InChI=1S/C12H14FNO5S/c13-11-4-3-9(6-10(11)12(16)17)20(18,19)14-5-1-2-8(14)7-15/h3-4,6,8,15H,1-2,5,7H2,(H,16,17) |
| InChIKey | ZZBNRCLIEYYBOJ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |