C11H14Cl2N2O2S — CID 124573759
[(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanamine (PubChem CID 124573759) has the molecular formula C11H14Cl2N2O2S and a molecular weight of 309.22 g/mol. Its IUPAC name is [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanamine.
| Compound Name | [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 124573759 |
| Molecular Formula | C11H14Cl2N2O2S |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | [(2S)-1-(3,5-dichlorophenyl)sulfonylpyrrolidin-2-yl]methanamine |
| SMILES | NC[C@@H]1CCCN1S(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O2S/c12-8-4-9(13)6-11(5-8)18(16,17)15-3-1-2-10(15)7-14/h4-6,10H,1-3,7,14H2/t10-/m0/s1 |
| InChIKey | POGJRVZKPAIGEZ-JTQLQIEISA-N |
| XLogP | 2.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |