C12H14ClF3N2O2S — CID 124591893
[(2S)-1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]methanamine (PubChem CID 124591893) has the molecular formula C12H14ClF3N2O2S and a molecular weight of 342.77 g/mol. Its IUPAC name is [(2S)-1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]methanamine.
| Compound Name | [(2S)-1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 124591893 |
| Molecular Formula | C12H14ClF3N2O2S |
| Molecular Weight | 342.77 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | [(2S)-1-[4-chloro-3-(trifluoromethyl)phenyl]sulfonylpyrrolidin-2-yl]methanamine |
| SMILES | NC[C@@H]1CCCN1S(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14ClF3N2O2S/c13-11-4-3-9(6-10(11)12(14,15)16)21(19,20)18-5-1-2-8(18)7-17/h3-4,6,8H,1-2,5,7,17H2/t8-/m0/s1 |
| InChIKey | ONJDCGQKCXOVAD-QMMMGPOBSA-N |
| XLogP | 2.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |