C12H16BrNO3S — CID 43574420
[1-(4-bromophenyl)sulfonylpiperidin-2-yl]methanol (PubChem CID 43574420) has the molecular formula C12H16BrNO3S and a molecular weight of 334.24 g/mol. Its IUPAC name is [1-(4-bromophenyl)sulfonylpiperidin-2-yl]methanol.
| Compound Name | [1-(4-bromophenyl)sulfonylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 43574420 |
| Molecular Formula | C12H16BrNO3S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | [1-(4-bromophenyl)sulfonylpiperidin-2-yl]methanol |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCCCC1CO |
| InChI | InChI=1S/C12H16BrNO3S/c13-10-4-6-12(7-5-10)18(16,17)14-8-2-1-3-11(14)9-15/h4-7,11,15H,1-3,8-9H2 |
| InChIKey | NNPBHDRLZPAUCH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |