C13H20BrNO3S — CID 143517096
[1-(4-bromophenyl)sulfonylpyrrolidin-2-yl]methanol;ethane (PubChem CID 143517096) has the molecular formula C13H20BrNO3S and a molecular weight of 350.28 g/mol. Its IUPAC name is [1-(4-bromophenyl)sulfonylpyrrolidin-2-yl]methanol;ethane.
| Compound Name | [1-(4-bromophenyl)sulfonylpyrrolidin-2-yl]methanol;ethane |
|---|---|
| PubChem CID | 143517096 |
| Molecular Formula | C13H20BrNO3S |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | [1-(4-bromophenyl)sulfonylpyrrolidin-2-yl]methanol;ethane |
| SMILES | CC.O=S(=O)(c1ccc(Br)cc1)N1CCCC1CO |
| InChI | InChI=1S/C11H14BrNO3S.C2H6/c12-9-3-5-11(6-4-9)17(15,16)13-7-1-2-10(13)8-14;1-2/h3-6,10,14H,1-2,7-8H2;1-2H3 |
| InChIKey | OEHLWQVPOYZBMV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |