C13H19ClN2O2S2 — CID 103100390
1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine (PubChem CID 103100390) has the molecular formula C13H19ClN2O2S2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine |
|---|---|
| PubChem CID | 103100390 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-2-pyrrolidin-2-ylpyrrolidine |
| SMILES | Cc1cc(S(=O)(=O)N2CCCC2C2CCCN2)sc1Cl |
| InChI | InChI=1S/C13H19ClN2O2S2/c1-9-8-12(19-13(9)14)20(17,18)16-7-3-5-11(16)10-4-2-6-15-10/h8,10-11,15H,2-7H2,1H3 |
| InChIKey | BRZCLNRZYRMBTK-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |