C9H13ClN2O2S2 — CID 103100505
(3S)-1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine (PubChem CID 103100505) has the molecular formula C9H13ClN2O2S2 and a molecular weight of 280.80 g/mol. Its IUPAC name is (3S)-1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine.
| Compound Name | (3S)-1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 103100505 |
| Molecular Formula | C9H13ClN2O2S2 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (3S)-1-(5-chloro-4-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine |
| SMILES | Cc1cc(S(=O)(=O)N2CC[C@H](N)C2)sc1Cl |
| InChI | InChI=1S/C9H13ClN2O2S2/c1-6-4-8(15-9(6)10)16(13,14)12-3-2-7(11)5-12/h4,7H,2-3,5,11H2,1H3/t7-/m0/s1 |
| InChIKey | DJZACBKSDYKJJJ-ZETCQYMHSA-N |
| XLogP | 1.43 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |