C10H16Cl2N2O2S2 — CID 120713704
1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-4-methylpyrrolidin-3-amine;hydrochloride (PubChem CID 120713704) has the molecular formula C10H16Cl2N2O2S2 and a molecular weight of 331.29 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-4-methylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-4-methylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120713704 |
| Molecular Formula | C10H16Cl2N2O2S2 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-4-methylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)C(N)C2)sc1Cl.Cl |
| InChI | InChI=1S/C10H15ClN2O2S2.ClH/c1-6-3-9(16-10(6)11)17(14,15)13-4-7(2)8(12)5-13;/h3,7-8H,4-5,12H2,1-2H3;1H |
| InChIKey | DRLXRKOWSUXSDZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |