C12H16ClNO4S2 — CID 122106054
1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122106054) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106054 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 1-(5-chloro-4-methylthiophen-2-yl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)CC(C(=O)O)C2)sc1Cl |
| InChI | InChI=1S/C12H16ClNO4S2/c1-7-3-9(12(15)16)6-14(5-7)20(17,18)10-4-8(2)11(13)19-10/h4,7,9H,3,5-6H2,1-2H3,(H,15,16) |
| InChIKey | VXUANJBJOLECLR-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |