C15H21NO4S — CID 122105508
1-(3,4-dimethylphenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122105508) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(3,4-dimethylphenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105508 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C)CC(C(=O)O)C2)cc1C |
| InChI | InChI=1S/C15H21NO4S/c1-10-6-13(15(17)18)9-16(8-10)21(19,20)14-5-4-11(2)12(3)7-14/h4-5,7,10,13H,6,8-9H2,1-3H3,(H,17,18) |
| InChIKey | PSRLIEHMSGFZPI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |