C13H14F3NO4S — CID 122105614
5-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 122105614) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is 5-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105614 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 5-methyl-1-(3,4,5-trifluorophenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(S(=O)(=O)c2cc(F)c(F)c(F)c2)C1 |
| InChI | InChI=1S/C13H14F3NO4S/c1-7-2-8(13(18)19)6-17(5-7)22(20,21)9-3-10(14)12(16)11(15)4-9/h3-4,7-8H,2,5-6H2,1H3,(H,18,19) |
| InChIKey | ZSRMPZYQCZVJLL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|