C15H21NO5S — CID 122105911
1-[3-(methoxymethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122105911) has the molecular formula C15H21NO5S and a molecular weight of 327.40 g/mol. Its IUPAC name is 1-[3-(methoxymethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[3-(methoxymethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105911 |
| Molecular Formula | C15H21NO5S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 1-[3-(methoxymethyl)phenyl]sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | COCc1cccc(S(=O)(=O)N2CC(C)CC(C(=O)O)C2)c1 |
| InChI | InChI=1S/C15H21NO5S/c1-11-6-13(15(17)18)9-16(8-11)22(19,20)14-5-3-4-12(7-14)10-21-2/h3-5,7,11,13H,6,8-10H2,1-2H3,(H,17,18) |
| InChIKey | WQBBABRABAFAEF-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |