C14H19NO5S — CID 136580990
(3R)-1-[3-(methoxymethyl)phenyl]sulfonylpiperidine-3-carboxylic acid (PubChem CID 136580990) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is (3R)-1-[3-(methoxymethyl)phenyl]sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[3-(methoxymethyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 136580990 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (3R)-1-[3-(methoxymethyl)phenyl]sulfonylpiperidine-3-carboxylic acid |
| SMILES | COCc1cccc(S(=O)(=O)N2CCC[C@@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C14H19NO5S/c1-20-10-11-4-2-6-13(8-11)21(18,19)15-7-3-5-12(9-15)14(16)17/h2,4,6,8,12H,3,5,7,9-10H2,1H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | RUJZCLIFHIFZMT-GFCCVEGCSA-N |
| XLogP | 1.32 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |