C13H18ClNO4S — CID 120716574
1-(3-ethylphenyl)sulfonylpyrrolidine-3-carboxylic acid;hydrochloride (PubChem CID 120716574) has the molecular formula C13H18ClNO4S and a molecular weight of 319.81 g/mol. Its IUPAC name is 1-(3-ethylphenyl)sulfonylpyrrolidine-3-carboxylic acid;hydrochloride.
| Compound Name | 1-(3-ethylphenyl)sulfonylpyrrolidine-3-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120716574 |
| Molecular Formula | C13H18ClNO4S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 1-(3-ethylphenyl)sulfonylpyrrolidine-3-carboxylic acid;hydrochloride |
| SMILES | CCc1cccc(S(=O)(=O)N2CCC(C(=O)O)C2)c1.Cl |
| InChI | InChI=1S/C13H17NO4S.ClH/c1-2-10-4-3-5-12(8-10)19(17,18)14-7-6-11(9-14)13(15)16;/h3-5,8,11H,2,6-7,9H2,1H3,(H,15,16);1H |
| InChIKey | DPDAMLRQBMFNFT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |