C15H23NO3S — CID 95739230
(3S,5S)-1-[3-(methoxymethyl)phenyl]sulfonyl-3,5-dimethylpiperidine (PubChem CID 95739230) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is (3S,5S)-1-[3-(methoxymethyl)phenyl]sulfonyl-3,5-dimethylpiperidine.
| Compound Name | (3S,5S)-1-[3-(methoxymethyl)phenyl]sulfonyl-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 95739230 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (3S,5S)-1-[3-(methoxymethyl)phenyl]sulfonyl-3,5-dimethylpiperidine |
| SMILES | COCc1cccc(S(=O)(=O)N2C[C@@H](C)C[C@H](C)C2)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-12-7-13(2)10-16(9-12)20(17,18)15-6-4-5-14(8-15)11-19-3/h4-6,8,12-13H,7,9-11H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | YPICBEZICRMRPM-STQMWFEESA-N |
| XLogP | 2.50 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |