C20H24N2O4S — CID 25354150
pyridin-3-ylmethyl 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 25354150) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is pyridin-3-ylmethyl 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | pyridin-3-ylmethyl 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 25354150 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | pyridin-3-ylmethyl 3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2cccc(C(=O)OCc3cccnc3)c2)C1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-9-16(2)13-22(12-15)27(24,25)19-7-3-6-18(10-19)20(23)26-14-17-5-4-8-21-11-17/h3-8,10-11,15-16H,9,12-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | ZMNDRWAWTILOMB-HZPDHXFCSA-N |
| XLogP | 3.11 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |