C20H22ClNO4S — CID 16548573
(4-chlorophenyl) 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 16548573) has the molecular formula C20H22ClNO4S and a molecular weight of 407.92 g/mol. Its IUPAC name is (4-chlorophenyl) 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | (4-chlorophenyl) 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 16548573 |
| Molecular Formula | C20H22ClNO4S |
| Molecular Weight | 407.92 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (4-chlorophenyl) 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2cccc(C(=O)Oc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C20H22ClNO4S/c1-14-10-15(2)13-22(12-14)27(24,25)19-5-3-4-16(11-19)20(23)26-18-8-6-17(21)7-9-18/h3-9,11,14-15H,10,12-13H2,1-2H3 |
| InChIKey | BCCVQVZTXVMUKN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.92 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|