C24H25NO4S — CID 7926804
naphthalen-2-yl 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate (PubChem CID 7926804) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is naphthalen-2-yl 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate.
| Compound Name | naphthalen-2-yl 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7926804 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | naphthalen-2-yl 4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylbenzoate |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(C(=O)Oc3ccc4ccccc4c3)cc2)C1 |
| InChI | InChI=1S/C24H25NO4S/c1-17-13-18(2)16-25(15-17)30(27,28)23-11-8-20(9-12-23)24(26)29-22-10-7-19-5-3-4-6-21(19)14-22/h3-12,14,17-18H,13,15-16H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | FAGSIAMTUCYXLB-QZTJIDSGSA-N |
| XLogP | 4.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|