C19H20FNO5S — CID 8779230
(3-fluorophenyl) 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 8779230) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is (3-fluorophenyl) 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | (3-fluorophenyl) 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 8779230 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (3-fluorophenyl) 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Oc3cccc(F)c3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H20FNO5S/c1-13-11-21(12-14(2)25-13)27(23,24)18-8-6-15(7-9-18)19(22)26-17-5-3-4-16(20)10-17/h3-10,13-14H,11-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JBRNAXKASGZYTK-KBPBESRZSA-N |
| XLogP | 2.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|