C20H21NO7S — CID 7913415
1,3-benzodioxol-5-yl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate (PubChem CID 7913415) has the molecular formula C20H21NO7S and a molecular weight of 419.46 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate.
| Compound Name | 1,3-benzodioxol-5-yl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 7913415 |
| Molecular Formula | C20H21NO7S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylbenzoate |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)Oc3ccc4c(c3)OCO4)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C20H21NO7S/c1-13-10-21(11-14(2)27-13)29(23,24)17-6-3-15(4-7-17)20(22)28-16-5-8-18-19(9-16)26-12-25-18/h3-9,13-14H,10-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | CPXVQXLDXWEYTM-KBPBESRZSA-N |
| XLogP | 2.43 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|