C18H25NO4S — CID 55355211
2-methylprop-2-enyl 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate (PubChem CID 55355211) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is 2-methylprop-2-enyl 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate.
| Compound Name | 2-methylprop-2-enyl 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 55355211 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-methylprop-2-enyl 3-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoate |
| SMILES | C=C(C)COC(=O)c1cccc(S(=O)(=O)N2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C18H25NO4S/c1-13(2)12-23-18(20)16-6-5-7-17(9-16)24(21,22)19-10-14(3)8-15(4)11-19/h5-7,9,14-15H,1,8,10-12H2,2-4H3 |
| InChIKey | SIMUNBYDDORBFS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|