C14H18N2O7S — CID 122105513
1-(4-methoxy-3-nitrophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid (PubChem CID 122105513) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is 1-(4-methoxy-3-nitrophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(4-methoxy-3-nitrophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105513 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-(4-methoxy-3-nitrophenyl)sulfonyl-5-methylpiperidine-3-carboxylic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CC(C)CC(C(=O)O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H18N2O7S/c1-9-5-10(14(17)18)8-15(7-9)24(21,22)11-3-4-13(23-2)12(6-11)16(19)20/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,17,18) |
| InChIKey | GJFQKBDYAPLTSZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|