C16H21N3O6 — CID 122122368
1-[(4-methoxy-3-nitrophenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122122368) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-[(4-methoxy-3-nitrophenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[(4-methoxy-3-nitrophenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122122368 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[(4-methoxy-3-nitrophenyl)methylcarbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | COc1ccc(CNC(=O)N2CC(C)CC(C(=O)O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H21N3O6/c1-10-5-12(15(20)21)9-18(8-10)16(22)17-7-11-3-4-14(25-2)13(6-11)19(23)24/h3-4,6,10,12H,5,7-9H2,1-2H3,(H,17,22)(H,20,21) |
| InChIKey | KYIWLHISCQHRSS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 122.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|