C15H21NO6S2 — CID 122105633
5-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 122105633) has the molecular formula C15H21NO6S2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 5-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122105633 |
| Molecular Formula | C15H21NO6S2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 5-methyl-1-(2-methyl-5-methylsulfonylphenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1S(=O)(=O)N1CC(C)CC(C(=O)O)C1 |
| InChI | InChI=1S/C15H21NO6S2/c1-10-6-12(15(17)18)9-16(8-10)24(21,22)14-7-13(23(3,19)20)5-4-11(14)2/h4-5,7,10,12H,6,8-9H2,1-3H3,(H,17,18) |
| InChIKey | XRPKZDZGYUVWLY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |