About 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine
1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine (PubChem CID 107328373) has the molecular formula C13H19FN2O2S
and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine |
| PubChem CID | 107328373 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CC(C)C(N)C1 |
| InChI | InChI=1S/C13H19FN2O2S/c1-8-4-11(14)5-9(2)13(8)19(17,18)16-6-10(3)12(15)7-16/h4-5,10,12H,6-7,15H2,1-3H3 |
| InChIKey | OIKHALQRRVOFDI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine?
The IUPAC name of 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine (CID 107328373) is 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine.
What is the SMILES notation for 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine?
The canonical SMILES for 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine is Cc1cc(F)cc(C)c1S(=O)(=O)N1CC(C)C(N)C1.
What is the InChIKey of 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine?
The InChIKey is OIKHALQRRVOFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O2S/c1-8-4-11(14)5-9(2)13(8)19(17,18)16-6-10(3)12(15)7-16/h4-5,10,12H,6-7,15H2,1-3H3.
What are the key properties of 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine?
1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine has a molecular weight of 286.37 g/mol, XLogP of 1.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-4-methylpyrrolidin-3-amine is sourced from PubChem (CID 107328373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).