C16H24FNO2S — CID 107327541
1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,3,5-trimethylpiperidine (PubChem CID 107327541) has the molecular formula C16H24FNO2S and a molecular weight of 313.44 g/mol. Its IUPAC name is 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,3,5-trimethylpiperidine.
| Compound Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 107327541 |
| Molecular Formula | C16H24FNO2S |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(4-fluoro-2,6-dimethylphenyl)sulfonyl-2,3,5-trimethylpiperidine |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)N1CC(C)CC(C)C1C |
| InChI | InChI=1S/C16H24FNO2S/c1-10-6-11(2)14(5)18(9-10)21(19,20)16-12(3)7-15(17)8-13(16)4/h7-8,10-11,14H,6,9H2,1-5H3 |
| InChIKey | YSGVGHDOAOIPAR-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |