C16H26N2O2S — CID 114591939
2,5-dimethyl-3-(2,3,5-trimethylpiperidin-1-yl)sulfonylaniline (PubChem CID 114591939) has the molecular formula C16H26N2O2S and a molecular weight of 310.46 g/mol. Its IUPAC name is 2,5-dimethyl-3-(2,3,5-trimethylpiperidin-1-yl)sulfonylaniline.
| Compound Name | 2,5-dimethyl-3-(2,3,5-trimethylpiperidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 114591939 |
| Molecular Formula | C16H26N2O2S |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 2,5-dimethyl-3-(2,3,5-trimethylpiperidin-1-yl)sulfonylaniline |
| SMILES | Cc1cc(N)c(C)c(S(=O)(=O)N2CC(C)CC(C)C2C)c1 |
| InChI | InChI=1S/C16H26N2O2S/c1-10-7-15(17)13(4)16(8-10)21(19,20)18-9-11(2)6-12(3)14(18)5/h7-8,11-12,14H,6,9,17H2,1-5H3 |
| InChIKey | HSHFDERTXZIENS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|