C15H22BrNO2S — CID 114594701
1-(4-bromo-3-methylphenyl)sulfonyl-2,3,5-trimethylpiperidine (PubChem CID 114594701) has the molecular formula C15H22BrNO2S and a molecular weight of 360.32 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)sulfonyl-2,3,5-trimethylpiperidine.
| Compound Name | 1-(4-bromo-3-methylphenyl)sulfonyl-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 114594701 |
| Molecular Formula | C15H22BrNO2S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)sulfonyl-2,3,5-trimethylpiperidine |
| SMILES | Cc1cc(S(=O)(=O)N2CC(C)CC(C)C2C)ccc1Br |
| InChI | InChI=1S/C15H22BrNO2S/c1-10-7-11(2)13(4)17(9-10)20(18,19)14-5-6-15(16)12(3)8-14/h5-6,8,10-11,13H,7,9H2,1-4H3 |
| InChIKey | RPVGKDDZWUVNPH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |