C13H19BrN2O2S — CID 120725401
1-(4-bromo-3-methylphenyl)sulfonyl-2,3-dimethylpiperazine (PubChem CID 120725401) has the molecular formula C13H19BrN2O2S and a molecular weight of 347.28 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)sulfonyl-2,3-dimethylpiperazine.
| Compound Name | 1-(4-bromo-3-methylphenyl)sulfonyl-2,3-dimethylpiperazine |
|---|---|
| PubChem CID | 120725401 |
| Molecular Formula | C13H19BrN2O2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)sulfonyl-2,3-dimethylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCNC(C)C2C)ccc1Br |
| InChI | InChI=1S/C13H19BrN2O2S/c1-9-8-12(4-5-13(9)14)19(17,18)16-7-6-15-10(2)11(16)3/h4-5,8,10-11,15H,6-7H2,1-3H3 |
| InChIKey | QAZNEDWYSBKDHB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |