C12H16BrNO2S2 — CID 113231761
4-(4-bromo-3-methylphenyl)sulfonyl-2-methylthiomorpholine (PubChem CID 113231761) has the molecular formula C12H16BrNO2S2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 4-(4-bromo-3-methylphenyl)sulfonyl-2-methylthiomorpholine.
| Compound Name | 4-(4-bromo-3-methylphenyl)sulfonyl-2-methylthiomorpholine |
|---|---|
| PubChem CID | 113231761 |
| Molecular Formula | C12H16BrNO2S2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | 4-(4-bromo-3-methylphenyl)sulfonyl-2-methylthiomorpholine |
| SMILES | Cc1cc(S(=O)(=O)N2CCSC(C)C2)ccc1Br |
| InChI | InChI=1S/C12H16BrNO2S2/c1-9-7-11(3-4-12(9)13)18(15,16)14-5-6-17-10(2)8-14/h3-4,7,10H,5-6,8H2,1-2H3 |
| InChIKey | PZSDBDVOHUTESL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |