C14H19BrFNO2S — CID 107650396
1-(4-bromo-3-fluorophenyl)sulfonyl-2,3,5-trimethylpiperidine (PubChem CID 107650396) has the molecular formula C14H19BrFNO2S and a molecular weight of 364.28 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)sulfonyl-2,3,5-trimethylpiperidine.
| Compound Name | 1-(4-bromo-3-fluorophenyl)sulfonyl-2,3,5-trimethylpiperidine |
|---|---|
| PubChem CID | 107650396 |
| Molecular Formula | C14H19BrFNO2S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)sulfonyl-2,3,5-trimethylpiperidine |
| SMILES | CC1CC(C)C(C)N(S(=O)(=O)c2ccc(Br)c(F)c2)C1 |
| InChI | InChI=1S/C14H19BrFNO2S/c1-9-6-10(2)11(3)17(8-9)20(18,19)12-4-5-13(15)14(16)7-12/h4-5,7,9-11H,6,8H2,1-3H3 |
| InChIKey | MIGOFCQJGMQJKI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |