C9H15ClN2O2S2 — CID 119971533
1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119971533) has the molecular formula C9H15ClN2O2S2 and a molecular weight of 282.82 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119971533 |
| Molecular Formula | C9H15ClN2O2S2 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(N)C2)s1.Cl |
| InChI | InChI=1S/C9H14N2O2S2.ClH/c1-7-2-3-9(14-7)15(12,13)11-5-4-8(10)6-11;/h2-3,8H,4-6,10H2,1H3;1H |
| InChIKey | FSNCQEZDNMWIKA-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |