C13H23ClN2O2S2 — CID 119959754
1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-amine;hydrochloride (PubChem CID 119959754) has the molecular formula C13H23ClN2O2S2 and a molecular weight of 338.93 g/mol. Its IUPAC name is 1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-amine;hydrochloride.
| Compound Name | 1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119959754 |
| Molecular Formula | C13H23ClN2O2S2 |
| Molecular Weight | 338.93 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-amine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCCC(N)C2)s1.Cl |
| InChI | InChI=1S/C13H22N2O2S2.ClH/c1-13(2,3)11-6-7-12(18-11)19(16,17)15-8-4-5-10(14)9-15;/h6-7,10H,4-5,8-9,14H2,1-3H3;1H |
| InChIKey | KIBVVKGDSDZELH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.93 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |