C15H27ClN2O2S2 — CID 119984523
1-[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride (PubChem CID 119984523) has the molecular formula C15H27ClN2O2S2 and a molecular weight of 366.98 g/mol. Its IUPAC name is 1-[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride.
| Compound Name | 1-[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 119984523 |
| Molecular Formula | C15H27ClN2O2S2 |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-3-yl]ethanamine;hydrochloride |
| SMILES | CC(N)C1CCCN(S(=O)(=O)c2ccc(C(C)(C)C)s2)C1.Cl |
| InChI | InChI=1S/C15H26N2O2S2.ClH/c1-11(16)12-6-5-9-17(10-12)21(18,19)14-8-7-13(20-14)15(2,3)4;/h7-8,11-12H,5-6,9-10,16H2,1-4H3;1H |
| InChIKey | DUJWDKYDGANLAR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |