C13H19NO3S2 — CID 121197707
3-(cyclopropylmethoxy)-1-(5-methylthiophen-2-yl)sulfonylpyrrolidine (PubChem CID 121197707) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 3-(cyclopropylmethoxy)-1-(5-methylthiophen-2-yl)sulfonylpyrrolidine.
| Compound Name | 3-(cyclopropylmethoxy)-1-(5-methylthiophen-2-yl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 121197707 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 3-(cyclopropylmethoxy)-1-(5-methylthiophen-2-yl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(OCC3CC3)C2)s1 |
| InChI | InChI=1S/C13H19NO3S2/c1-10-2-5-13(18-10)19(15,16)14-7-6-12(8-14)17-9-11-3-4-11/h2,5,11-12H,3-4,6-9H2,1H3 |
| InChIKey | HUXRGRBCEKDKQU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |