C14H19N3O2S2 — CID 106272816
5-(2-pyrrolidin-2-ylpiperidin-1-yl)sulfonylthiophene-2-carbonitrile (PubChem CID 106272816) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 5-(2-pyrrolidin-2-ylpiperidin-1-yl)sulfonylthiophene-2-carbonitrile.
| Compound Name | 5-(2-pyrrolidin-2-ylpiperidin-1-yl)sulfonylthiophene-2-carbonitrile |
|---|---|
| PubChem CID | 106272816 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 5-(2-pyrrolidin-2-ylpiperidin-1-yl)sulfonylthiophene-2-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCCCC2C2CCCN2)s1 |
| InChI | InChI=1S/C14H19N3O2S2/c15-10-11-6-7-14(20-11)21(18,19)17-9-2-1-5-13(17)12-4-3-8-16-12/h6-7,12-13,16H,1-5,8-9H2 |
| InChIKey | OQCFVMGCGRPGOW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |