C11H12N2O4S2 — CID 114165885
1-(5-cyanothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid (PubChem CID 114165885) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114165885 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperidine-2-carboxylic acid |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCCCC2C(=O)O)s1 |
| InChI | InChI=1S/C11H12N2O4S2/c12-7-8-4-5-10(18-8)19(16,17)13-6-2-1-3-9(13)11(14)15/h4-5,9H,1-3,6H2,(H,14,15) |
| InChIKey | JARGDGGOVRXAAP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |