C10H10N4O2S2 — CID 106272927
1-(5-cyanothiophen-2-yl)sulfonylpiperazine-2-carbonitrile (PubChem CID 106272927) has the molecular formula C10H10N4O2S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-(5-cyanothiophen-2-yl)sulfonylpiperazine-2-carbonitrile.
| Compound Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperazine-2-carbonitrile |
|---|---|
| PubChem CID | 106272927 |
| Molecular Formula | C10H10N4O2S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-(5-cyanothiophen-2-yl)sulfonylpiperazine-2-carbonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)N2CCNCC2C#N)s1 |
| InChI | InChI=1S/C10H10N4O2S2/c11-5-8-7-13-3-4-14(8)18(15,16)10-2-1-9(6-12)17-10/h1-2,8,13H,3-4,7H2 |
| InChIKey | IFPZKADDWVXFQJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |